C18H33NO2Si — CID 11255772
(5R,6R,7S,8S,8aS)-8-ethyl-7-hydroxy-5-propyl-6-(1-trimethylsilylethenyl)-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11255772) has the molecular formula C18H33NO2Si and a molecular weight of 323.55 g/mol. Its IUPAC name is (5R,6R,7S,8S,8aS)-8-ethyl-7-hydroxy-5-propyl-6-(1-trimethylsilylethenyl)-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5R,6R,7S,8S,8aS)-8-ethyl-7-hydroxy-5-propyl-6-(1-trimethylsilylethenyl)-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11255772 |
| Molecular Formula | C18H33NO2Si |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | (5R,6R,7S,8S,8aS)-8-ethyl-7-hydroxy-5-propyl-6-(1-trimethylsilylethenyl)-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C=C([C@H]1[C@@H](O)[C@@H](CC)[C@@H]2CCC(=O)N2[C@@H]1CCC)[Si](C)(C)C |
| InChI | InChI=1S/C18H33NO2Si/c1-7-9-15-17(12(3)22(4,5)6)18(21)13(8-2)14-10-11-16(20)19(14)15/h13-15,17-18,21H,3,7-11H2,1-2,4-6H3/t13-,14-,15+,17+,18-/m0/s1 |
| InChIKey | QDUCCJKYLYPQIV-DTJSUFBGSA-N |
| XLogP | 3.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|