C17H31NO2Si — CID 15816222
(7S,8S,8aS)-8-[(E)-prop-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 15816222) has the molecular formula C17H31NO2Si and a molecular weight of 309.53 g/mol. Its IUPAC name is (7S,8S,8aS)-8-[(E)-prop-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (7S,8S,8aS)-8-[(E)-prop-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 15816222 |
| Molecular Formula | C17H31NO2Si |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (7S,8S,8aS)-8-[(E)-prop-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C/C=C/[C@@H]1[C@@H](O[Si](CC)(CC)CC)CCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C17H31NO2Si/c1-5-9-14-15-10-11-17(19)18(15)13-12-16(14)20-21(6-2,7-3)8-4/h5,9,14-16H,6-8,10-13H2,1-4H3/b9-5+/t14-,15-,16-/m0/s1 |
| InChIKey | LDXKLIJXJQTAIJ-BIYXSLEMSA-N |
| XLogP | 3.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|