C18H33NO2Si — CID 10990941
(7S,8S,8aS)-8-[(E)-but-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 10990941) has the molecular formula C18H33NO2Si and a molecular weight of 323.55 g/mol. Its IUPAC name is (7S,8S,8aS)-8-[(E)-but-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (7S,8S,8aS)-8-[(E)-but-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 10990941 |
| Molecular Formula | C18H33NO2Si |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | (7S,8S,8aS)-8-[(E)-but-1-enyl]-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC/C=C/[C@@H]1[C@@H](O[Si](CC)(CC)CC)CCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H33NO2Si/c1-5-9-10-15-16-11-12-18(20)19(16)14-13-17(15)21-22(6-2,7-3)8-4/h9-10,15-17H,5-8,11-14H2,1-4H3/b10-9+/t15-,16-,17-/m0/s1 |
| InChIKey | RLHDUFOEOKLUFG-DHLHQBBISA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|