C16H13N3O2 — CID 11380444
N-(2-hydroxyphenyl)-2-methyl-1,8-naphthyridine-3-carboxamide (PubChem CID 11380444) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2-methyl-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-2-methyl-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 11380444 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(2-hydroxyphenyl)-2-methyl-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1nc2ncccc2cc1C(=O)Nc1ccccc1O |
| InChI | InChI=1S/C16H13N3O2/c1-10-12(9-11-5-4-8-17-15(11)18-10)16(21)19-13-6-2-3-7-14(13)20/h2-9,20H,1H3,(H,19,21) |
| InChIKey | JALLMFCFQNXBQO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|