C17H16N4O — CID 46947659
1-(2-methyl-1,8-naphthyridin-3-yl)-3-(4-methylphenyl)urea (PubChem CID 46947659) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-(2-methyl-1,8-naphthyridin-3-yl)-3-(4-methylphenyl)urea.
| Compound Name | 1-(2-methyl-1,8-naphthyridin-3-yl)-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 46947659 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-(2-methyl-1,8-naphthyridin-3-yl)-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc3cccnc3nc2C)cc1 |
| InChI | InChI=1S/C17H16N4O/c1-11-5-7-14(8-6-11)20-17(22)21-15-10-13-4-3-9-18-16(13)19-12(15)2/h3-10H,1-2H3,(H2,20,21,22) |
| InChIKey | GHASDXXZGRPYPU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |