C14H17N3O2 — CID 11311488
butyl N-(2-methyl-1,8-naphthyridin-3-yl)carbamate (PubChem CID 11311488) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is butyl N-(2-methyl-1,8-naphthyridin-3-yl)carbamate.
| Compound Name | butyl N-(2-methyl-1,8-naphthyridin-3-yl)carbamate |
|---|---|
| PubChem CID | 11311488 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | butyl N-(2-methyl-1,8-naphthyridin-3-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1cc2cccnc2nc1C |
| InChI | InChI=1S/C14H17N3O2/c1-3-4-8-19-14(18)17-12-9-11-6-5-7-15-13(11)16-10(12)2/h5-7,9H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | HCTMPGKJEMCKMM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|