C17H16N4O2 — CID 46947661
1-(3-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-3-yl)urea (PubChem CID 46947661) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-3-yl)urea.
| Compound Name | 1-(3-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-3-yl)urea |
|---|---|
| PubChem CID | 46947661 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-3-yl)urea |
| SMILES | COc1cccc(NC(=O)Nc2cc3cccnc3nc2C)c1 |
| InChI | InChI=1S/C17H16N4O2/c1-11-15(9-12-5-4-8-18-16(12)19-11)21-17(22)20-13-6-3-7-14(10-13)23-2/h3-10H,1-2H3,(H2,20,21,22) |
| InChIKey | MSLJRELHRGFYBL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |