C13H20F3NO3 — CID 11380877
tert-butyl (4R)-2,2-dimethyl-4-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-oxazolidine-3-carboxylate (PubChem CID 11380877) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11380877 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C([C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c1-8(13(14,15)16)9-7-19-12(5,6)17(9)10(18)20-11(2,3)4/h9H,1,7H2,2-6H3/t9-/m0/s1 |
| InChIKey | QYAXXSMOTHSXEO-VIFPVBQESA-N |
| XLogP | 3.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|