About (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one
(E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one (PubChem CID 11382353) has the molecular formula C22H32O3
and a molecular weight of 344.50 g/mol. Its IUPAC name is (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one.
Molecular Properties
| Compound Name | (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one |
| PubChem CID | 11382353 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one |
| SMILES | CCCCCCCC(=O)/C=C/C#CC#CCCCOC1CCCCO1 |
| InChI | InChI=1S/C22H32O3/c1-2-3-4-8-11-16-21(23)17-12-9-6-5-7-10-14-19-24-22-18-13-15-20-25-22/h12,17,22H,2-4,8,10-11,13-16,18-20H2,1H3/b17-12+ |
| InChIKey | VCMBPQYOENSLEH-SFQUDFHCSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one?
The IUPAC name of (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one (CID 11382353) is (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one.
What is the SMILES notation for (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one?
The canonical SMILES for (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one is CCCCCCCC(=O)/C=C/C#CC#CCCCOC1CCCCO1.
What is the InChIKey of (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one?
The InChIKey is VCMBPQYOENSLEH-SFQUDFHCSA-N. The full InChI is InChI=1S/C22H32O3/c1-2-3-4-8-11-16-21(23)17-12-9-6-5-7-10-14-19-24-22-18-13-15-20-25-22/h12,17,22H,2-4,8,10-11,13-16,18-20H2,1H3/b17-12+.
What are the key properties of (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one?
(E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one has a molecular weight of 344.50 g/mol, XLogP of 4.80, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-17-(oxan-2-yloxy)heptadec-9-en-11,13-diyn-8-one is sourced from PubChem (CID 11382353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).