C22H30O3 — CID 102465611
(7E,9E)-17-(oxan-2-yloxy)heptadeca-7,9-dien-11,13-diyn-6-one (PubChem CID 102465611) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (7E,9E)-17-(oxan-2-yloxy)heptadeca-7,9-dien-11,13-diyn-6-one.
| Compound Name | (7E,9E)-17-(oxan-2-yloxy)heptadeca-7,9-dien-11,13-diyn-6-one |
|---|---|
| PubChem CID | 102465611 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (7E,9E)-17-(oxan-2-yloxy)heptadeca-7,9-dien-11,13-diyn-6-one |
| SMILES | CCCCCC(=O)/C=C/C=C/C#CC#CCCCOC1CCCCO1 |
| InChI | InChI=1S/C22H30O3/c1-2-3-11-16-21(23)17-12-9-7-5-4-6-8-10-14-19-24-22-18-13-15-20-25-22/h7,9,12,17,22H,2-3,10-11,13-16,18-20H2,1H3/b9-7+,17-12+ |
| InChIKey | LDEZNHMGDUWFDQ-DGRUYDBLSA-N |
| XLogP | 4.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|