C20H36O3Si — CID 11382617
ethyl (E)-3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]prop-2-enoate (PubChem CID 11382617) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is ethyl (E)-3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11382617 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | ethyl (E)-3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@]12CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC2 |
| InChI | InChI=1S/C20H36O3Si/c1-7-22-18(21)12-15-20-13-8-10-16(20)17(11-9-14-20)23-24(5,6)19(2,3)4/h12,15-17H,7-11,13-14H2,1-6H3/b15-12+/t16-,17+,20-/m0/s1 |
| InChIKey | RAHPPAWZMYPXTO-LZGFNMTCSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|