C22H25NO3S — CID 11383510
(5S,9S)-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one (PubChem CID 11383510) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is (5S,9S)-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one.
| Compound Name | (5S,9S)-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 11383510 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (5S,9S)-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H](c3ccccc3)C[C@]23CCCC3=O)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-17-9-11-20(12-10-17)27(25,26)23-15-13-19(18-6-3-2-4-7-18)16-22(23)14-5-8-21(22)24/h2-4,6-7,9-12,19H,5,8,13-16H2,1H3/t19-,22-/m0/s1 |
| InChIKey | ZYWRNQACAFTWLD-UGKGYDQZSA-N |
| XLogP | 4.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |