About 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone
1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone (PubChem CID 53384231) has the molecular formula C20H23NO3S
and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone |
| PubChem CID | 53384231 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@@H](c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H23NO3S/c1-15-8-11-19(12-9-15)25(23,24)21-14-18(16(2)22)10-13-20(21)17-6-4-3-5-7-17/h3-9,11-12,18,20H,10,13-14H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | CDVIECWWKUMLHU-ICSRJNTNSA-N |
| XLogP | 3.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone?
The IUPAC name of 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone (CID 53384231) is 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone.
What is the SMILES notation for 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone?
The canonical SMILES for 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone is CC(=O)[C@H]1CC[C@@H](c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)C1.
What is the InChIKey of 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone?
The InChIKey is CDVIECWWKUMLHU-ICSRJNTNSA-N. The full InChI is InChI=1S/C20H23NO3S/c1-15-8-11-19(12-9-15)25(23,24)21-14-18(16(2)22)10-13-20(21)17-6-4-3-5-7-17/h3-9,11-12,18,20H,10,13-14H2,1-2H3/t18-,20-/m0/s1.
What are the key properties of 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone?
1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone has a molecular weight of 357.48 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,6S)-1-(4-methylphenyl)sulfonyl-6-phenylpiperidin-3-yl]ethanone is sourced from PubChem (CID 53384231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).