C21H28N4O3 — CID 11383535
benzyl N-[[2-[amino(2-methylpropyl)amino]acetyl]-benzylamino]carbamate (PubChem CID 11383535) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is benzyl N-[[2-[amino(2-methylpropyl)amino]acetyl]-benzylamino]carbamate.
| Compound Name | benzyl N-[[2-[amino(2-methylpropyl)amino]acetyl]-benzylamino]carbamate |
|---|---|
| PubChem CID | 11383535 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | benzyl N-[[2-[amino(2-methylpropyl)amino]acetyl]-benzylamino]carbamate |
| SMILES | CC(C)CN(N)CC(=O)N(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H28N4O3/c1-17(2)13-24(22)15-20(26)25(14-18-9-5-3-6-10-18)23-21(27)28-16-19-11-7-4-8-12-19/h3-12,17H,13-16,22H2,1-2H3,(H,23,27) |
| InChIKey | VAKBYQIDYROMKV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|