C15H18INO3 — CID 11383625
methyl (E,4S)-4-[(2-iodobenzoyl)amino]-5-methylhex-2-enoate (PubChem CID 11383625) has the molecular formula C15H18INO3 and a molecular weight of 387.22 g/mol. Its IUPAC name is methyl (E,4S)-4-[(2-iodobenzoyl)amino]-5-methylhex-2-enoate.
| Compound Name | methyl (E,4S)-4-[(2-iodobenzoyl)amino]-5-methylhex-2-enoate |
|---|---|
| PubChem CID | 11383625 |
| Molecular Formula | C15H18INO3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | methyl (E,4S)-4-[(2-iodobenzoyl)amino]-5-methylhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](NC(=O)c1ccccc1I)C(C)C |
| InChI | InChI=1S/C15H18INO3/c1-10(2)13(8-9-14(18)20-3)17-15(19)11-6-4-5-7-12(11)16/h4-10,13H,1-3H3,(H,17,19)/b9-8+/t13-/m1/s1 |
| InChIKey | JCDIQVPIEUCRID-MMQHEFTJSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|