C19H18ClF3N2O2 — CID 11383975
3-[[2-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]pyrrolidin-2-one (PubChem CID 11383975) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is 3-[[2-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]pyrrolidin-2-one.
| Compound Name | 3-[[2-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11383975 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-[[2-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]pyrrolidin-2-one |
| SMILES | O=C1NCCC1NCc1ccc(OCc2ccc(C(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C19H18ClF3N2O2/c20-16-9-15(6-3-13(16)10-25-17-7-8-24-18(17)26)27-11-12-1-4-14(5-2-12)19(21,22)23/h1-6,9,17,25H,7-8,10-11H2,(H,24,26) |
| InChIKey | BXRMIJNBBXXBSX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |