C17H18INO4 — CID 11384810
(1S,12S,14R)-14-hydroxy-7-iodo-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-5-one (PubChem CID 11384810) has the molecular formula C17H18INO4 and a molecular weight of 427.24 g/mol. Its IUPAC name is (1S,12S,14R)-14-hydroxy-7-iodo-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-5-one.
| Compound Name | (1S,12S,14R)-14-hydroxy-7-iodo-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-5-one |
|---|---|
| PubChem CID | 11384810 |
| Molecular Formula | C17H18INO4 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | (1S,12S,14R)-14-hydroxy-7-iodo-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-5-one |
| SMILES | COc1cc(I)c2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(C)C2=O |
| InChI | InChI=1S/C17H18INO4/c1-19-6-5-17-4-3-9(20)7-12(17)23-15-11(22-2)8-10(18)13(14(15)17)16(19)21/h3-4,8-9,12,20H,5-7H2,1-2H3/t9-,12-,17-/m0/s1 |
| InChIKey | WCHFRBKQJIWMIY-OVSFNBESSA-N |
| XLogP | 2.10 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|