C19H23BrN2O3 — CID 163498939
(14R)-7-bromo-9-methoxy-4-[2-(methylideneamino)ethyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-ol (PubChem CID 163498939) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is (14R)-7-bromo-9-methoxy-4-[2-(methylideneamino)ethyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-ol.
| Compound Name | (14R)-7-bromo-9-methoxy-4-[2-(methylideneamino)ethyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-ol |
|---|---|
| PubChem CID | 163498939 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (14R)-7-bromo-9-methoxy-4-[2-(methylideneamino)ethyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-ol |
| SMILES | C=NCCN1CCC23C=C[C@H](O)CC2Oc2c(OC)cc(Br)c(c23)C1 |
| InChI | InChI=1S/C19H23BrN2O3/c1-21-6-8-22-7-5-19-4-3-12(23)9-16(19)25-18-15(24-2)10-14(20)13(11-22)17(18)19/h3-4,10,12,16,23H,1,5-9,11H2,2H3/t12-,16?,19?/m0/s1 |
| InChIKey | CTBMMSWCNQUXIC-YHBQKQJXSA-N |
| XLogP | 2.68 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|