C24H24F2N4O2 — CID 11385090
N-(5-benzylpyrimidin-2-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide (PubChem CID 11385090) has the molecular formula C24H24F2N4O2 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-(5-benzylpyrimidin-2-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide.
| Compound Name | N-(5-benzylpyrimidin-2-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 11385090 |
| Molecular Formula | C24H24F2N4O2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-(5-benzylpyrimidin-2-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
| SMILES | CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1ncc(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C24H24F2N4O2/c1-2-6-21(29-22(31)12-17-10-19(25)13-20(26)11-17)23(32)30-24-27-14-18(15-28-24)9-16-7-4-3-5-8-16/h3-5,7-8,10-11,13-15,21H,2,6,9,12H2,1H3,(H,29,31)(H,27,28,30,32) |
| InChIKey | RRDLPNGLDIZFNR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |