C22H28F2N4O3 — CID 91166034
2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-pentoxypyrimidin-2-yl)pentanamide (PubChem CID 91166034) has the molecular formula C22H28F2N4O3 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-pentoxypyrimidin-2-yl)pentanamide.
| Compound Name | 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-pentoxypyrimidin-2-yl)pentanamide |
|---|---|
| PubChem CID | 91166034 |
| Molecular Formula | C22H28F2N4O3 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-pentoxypyrimidin-2-yl)pentanamide |
| SMILES | CCCCCOc1cnc(NC(=O)C(CCC)NC(=O)Cc2cc(F)cc(F)c2)nc1 |
| InChI | InChI=1S/C22H28F2N4O3/c1-3-5-6-8-31-18-13-25-22(26-14-18)28-21(30)19(7-4-2)27-20(29)11-15-9-16(23)12-17(24)10-15/h9-10,12-14,19H,3-8,11H2,1-2H3,(H,27,29)(H,25,26,28,30) |
| InChIKey | VCULSKRESAXXPB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|