C26H29F2N3O3S2 — CID 25010213
2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[5-(4-phenoxybutylsulfanyl)-1,3-thiazol-2-yl]pentanamide (PubChem CID 25010213) has the molecular formula C26H29F2N3O3S2 and a molecular weight of 533.67 g/mol. Its IUPAC name is 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[5-(4-phenoxybutylsulfanyl)-1,3-thiazol-2-yl]pentanamide.
| Compound Name | 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[5-(4-phenoxybutylsulfanyl)-1,3-thiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 25010213 |
| Molecular Formula | C26H29F2N3O3S2 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[5-(4-phenoxybutylsulfanyl)-1,3-thiazol-2-yl]pentanamide |
| SMILES | CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1ncc(SCCCCOc2ccccc2)s1 |
| InChI | InChI=1S/C26H29F2N3O3S2/c1-2-8-22(30-23(32)15-18-13-19(27)16-20(28)14-18)25(33)31-26-29-17-24(36-26)35-12-7-6-11-34-21-9-4-3-5-10-21/h3-5,9-10,13-14,16-17,22H,2,6-8,11-12,15H2,1H3,(H,30,32)(H,29,31,33) |
| InChIKey | IYAFQUSTUPZYKW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|