C22H25F3N4O3 — CID 11385397
1-methyl-3-(5-methyl-2-pyridinyl)-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea (PubChem CID 11385397) has the molecular formula C22H25F3N4O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is 1-methyl-3-(5-methyl-2-pyridinyl)-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea.
| Compound Name | 1-methyl-3-(5-methyl-2-pyridinyl)-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea |
|---|---|
| PubChem CID | 11385397 |
| Molecular Formula | C22H25F3N4O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1-methyl-3-(5-methyl-2-pyridinyl)-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea |
| SMILES | CCCc1c(OCCCN(C)C(=O)Nc2ccc(C)cn2)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C22H25F3N4O3/c1-4-6-15-17(9-8-16-19(15)32-28-20(16)22(23,24)25)31-12-5-11-29(3)21(30)27-18-10-7-14(2)13-26-18/h7-10,13H,4-6,11-12H2,1-3H3,(H,26,27,30) |
| InChIKey | KYOJCVHZLSWWNY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|