C27H30N4O3S — CID 11386306
N-[4-[4-(4-methoxyphenyl)-3-methylpiperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide (PubChem CID 11386306) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[4-[4-(4-methoxyphenyl)-3-methylpiperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | N-[4-[4-(4-methoxyphenyl)-3-methylpiperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 11386306 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[4-[4-(4-methoxyphenyl)-3-methylpiperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
| SMILES | COc1ccc(N2CCN(C(=O)C3CCCc4sc(NC(=O)c5ccccc5)nc43)CC2C)cc1 |
| InChI | InChI=1S/C27H30N4O3S/c1-18-17-30(15-16-31(18)20-11-13-21(34-2)14-12-20)26(33)22-9-6-10-23-24(22)28-27(35-23)29-25(32)19-7-4-3-5-8-19/h3-5,7-8,11-14,18,22H,6,9-10,15-17H2,1-2H3,(H,28,29,32) |
| InChIKey | IAPOCOHMKVNMBC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|