C23H29N3O2S — CID 16945692
N-[4-(3,5-dimethylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-methylbenzamide (PubChem CID 16945692) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[4-(3,5-dimethylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 16945692 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc3c(s2)CCCC3C(=O)N2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C23H29N3O2S/c1-14-7-9-17(10-8-14)21(27)25-23-24-20-18(5-4-6-19(20)29-23)22(28)26-12-15(2)11-16(3)13-26/h7-10,15-16,18H,4-6,11-13H2,1-3H3,(H,24,25,27) |
| InChIKey | XYDHTIHDDOEYKT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |