C20H20N4O2S2 — CID 16945800
2-[(4-methylbenzoyl)amino]-N-(4-methyl-1,3-thiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 16945800) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-[(4-methylbenzoyl)amino]-N-(4-methyl-1,3-thiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | 2-[(4-methylbenzoyl)amino]-N-(4-methyl-1,3-thiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 16945800 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[(4-methylbenzoyl)amino]-N-(4-methyl-1,3-thiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2nc3c(s2)CCCC3C(=O)Nc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C20H20N4O2S2/c1-11-6-8-13(9-7-11)17(25)23-20-22-16-14(4-3-5-15(16)28-20)18(26)24-19-21-12(2)10-27-19/h6-10,14H,3-5H2,1-2H3,(H,21,24,26)(H,22,23,25) |
| InChIKey | QDWUVBLQXXAQIL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |