C22H22N4O4S2 — CID 16945327
ethyl 2-[2-[(2-benzamido-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 16945327) has the molecular formula C22H22N4O4S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is ethyl 2-[2-[(2-benzamido-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(2-benzamido-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16945327 |
| Molecular Formula | C22H22N4O4S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | ethyl 2-[2-[(2-benzamido-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C2CCCc3sc(NC(=O)c4ccccc4)nc32)n1 |
| InChI | InChI=1S/C22H22N4O4S2/c1-2-30-17(27)11-14-12-31-21(23-14)26-20(29)15-9-6-10-16-18(15)24-22(32-16)25-19(28)13-7-4-3-5-8-13/h3-5,7-8,12,15H,2,6,9-11H2,1H3,(H,23,26,29)(H,24,25,28) |
| InChIKey | CTINFTYPFVQSKC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |