C23H23N3O2S — CID 40926076
(4R)-2-benzamido-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 40926076) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is (4R)-2-benzamido-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | (4R)-2-benzamido-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 40926076 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (4R)-2-benzamido-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCc3sc(NC(=O)c4ccccc4)nc32)cc1C |
| InChI | InChI=1S/C23H23N3O2S/c1-14-11-12-17(13-15(14)2)24-22(28)18-9-6-10-19-20(18)25-23(29-19)26-21(27)16-7-4-3-5-8-16/h3-5,7-8,11-13,18H,6,9-10H2,1-2H3,(H,24,28)(H,25,26,27)/t18-/m1/s1 |
| InChIKey | LRVGLARRGTWILU-GOSISDBHSA-N |
| XLogP | 5.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |