C22H18N4O2S2 — CID 16945328
2-benzamido-N-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 16945328) has the molecular formula C22H18N4O2S2 and a molecular weight of 434.55 g/mol. Its IUPAC name is 2-benzamido-N-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | 2-benzamido-N-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 16945328 |
| Molecular Formula | C22H18N4O2S2 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-benzamido-N-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCCC2C(=O)Nc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C22H18N4O2S2/c27-19(13-7-2-1-3-8-13)25-22-24-18-14(9-6-12-17(18)30-22)20(28)26-21-23-15-10-4-5-11-16(15)29-21/h1-5,7-8,10-11,14H,6,9,12H2,(H,23,26,28)(H,24,25,27) |
| InChIKey | LGANIMUASZZBAB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |