C28H30N6O3 — CID 11386451
1-[2-[5-[(4-phenoxyphenyl)carbamoylamino]indazol-1-yl]ethyl]piperidine-4-carboxamide (PubChem CID 11386451) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 1-[2-[5-[(4-phenoxyphenyl)carbamoylamino]indazol-1-yl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[5-[(4-phenoxyphenyl)carbamoylamino]indazol-1-yl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 11386451 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 1-[2-[5-[(4-phenoxyphenyl)carbamoylamino]indazol-1-yl]ethyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCn2ncc3cc(NC(=O)Nc4ccc(Oc5ccccc5)cc4)ccc32)CC1 |
| InChI | InChI=1S/C28H30N6O3/c29-27(35)20-12-14-33(15-13-20)16-17-34-26-11-8-23(18-21(26)19-30-34)32-28(36)31-22-6-9-25(10-7-22)37-24-4-2-1-3-5-24/h1-11,18-20H,12-17H2,(H2,29,35)(H2,31,32,36) |
| InChIKey | KIOITPZEEHNURK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |