C32H64O5Si3 — CID 11387926
[(4R,5Z,7S,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-triethylsilyloxyundeca-1,5-dien-4-yl] prop-2-enoate (PubChem CID 11387926) has the molecular formula C32H64O5Si3 and a molecular weight of 613.12 g/mol. Its IUPAC name is [(4R,5Z,7S,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-triethylsilyloxyundeca-1,5-dien-4-yl] prop-2-enoate.
| Compound Name | [(4R,5Z,7S,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-triethylsilyloxyundeca-1,5-dien-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11387926 |
| Molecular Formula | C32H64O5Si3 |
| Molecular Weight | 613.12 g/mol |
| Exact Mass | 612.41 |
| IUPAC Name | [(4R,5Z,7S,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-triethylsilyloxyundeca-1,5-dien-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](/C=C\[C@H](C[C@@H](O[Si](CC)(CC)CC)[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C32H64O5Si3/c1-17-22-27(34-30(33)18-2)23-24-28(36-39(15,16)32(10,11)12)25-29(37-40(19-3,20-4)21-5)26(6)35-38(13,14)31(7,8)9/h17-18,23-24,26-29H,1-2,19-22,25H2,3-16H3/b24-23-/t26-,27+,28+,29+/m0/s1 |
| InChIKey | MNJYLIJQJXCQOK-BKTYIZANSA-N |
| XLogP | 9.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.12 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|