C39H42O7S — CID 11388195
[(2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate (PubChem CID 11388195) has the molecular formula C39H42O7S and a molecular weight of 654.83 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 11388195 |
| Molecular Formula | C39H42O7S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C39H42O7S/c1-28-18-21-33(22-19-28)47-39-38(46-35(41)23-20-29(2)40)37(44-26-32-16-10-5-11-17-32)36(43-25-31-14-8-4-9-15-31)34(45-39)27-42-24-30-12-6-3-7-13-30/h3-19,21-22,34,36-39H,20,23-27H2,1-2H3/t34-,36+,37+,38-,39+/m1/s1 |
| InChIKey | PBOLISWFGKFZAT-DEPSEAIFSA-N |
| XLogP | 7.48 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |