C32H39N4O8PS — CID 11388290
[(2R)-3-[(2S)-2-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]piperidin-1-yl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-oxopropyl]sulfanylmethylphosphonic acid (PubChem CID 11388290) has the molecular formula C32H39N4O8PS and a molecular weight of 670.73 g/mol. Its IUPAC name is [(2R)-3-[(2S)-2-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]piperidin-1-yl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-oxopropyl]sulfanylmethylphosphonic acid.
| Compound Name | [(2R)-3-[(2S)-2-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]piperidin-1-yl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-oxopropyl]sulfanylmethylphosphonic acid |
|---|---|
| PubChem CID | 11388290 |
| Molecular Formula | C32H39N4O8PS |
| Molecular Weight | 670.73 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | [(2R)-3-[(2S)-2-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]piperidin-1-yl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-oxopropyl]sulfanylmethylphosphonic acid |
| SMILES | COc1ccc(CC(=O)N[C@@H](CSCP(=O)(O)O)C(=O)N2CCCC[C@H]2C(=O)N[C@@H](Cc2ccc3ccccc3c2)C(N)=O)cc1 |
| InChI | InChI=1S/C32H39N4O8PS/c1-44-25-13-10-21(11-14-25)18-29(37)34-27(19-46-20-45(41,42)43)32(40)36-15-5-4-8-28(36)31(39)35-26(30(33)38)17-22-9-12-23-6-2-3-7-24(23)16-22/h2-3,6-7,9-14,16,26-28H,4-5,8,15,17-20H2,1H3,(H2,33,38)(H,34,37)(H,35,39)(H2,41,42,43)/t26-,27-,28-/m0/s1 |
| InChIKey | JIFYJSOZGJOWMZ-KCHLEUMXSA-N |
| XLogP | 2.34 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.73 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|