C32H39N4O7PS — CID 69099657
[3-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)carbamoyl]piperidin-1-yl]-3-oxo-2-(3-phenylpropanoylamino)propyl]sulfanylmethylphosphonic acid (PubChem CID 69099657) has the molecular formula C32H39N4O7PS and a molecular weight of 654.73 g/mol. Its IUPAC name is [3-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)carbamoyl]piperidin-1-yl]-3-oxo-2-(3-phenylpropanoylamino)propyl]sulfanylmethylphosphonic acid.
| Compound Name | [3-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)carbamoyl]piperidin-1-yl]-3-oxo-2-(3-phenylpropanoylamino)propyl]sulfanylmethylphosphonic acid |
|---|---|
| PubChem CID | 69099657 |
| Molecular Formula | C32H39N4O7PS |
| Molecular Weight | 654.73 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | [3-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)carbamoyl]piperidin-1-yl]-3-oxo-2-(3-phenylpropanoylamino)propyl]sulfanylmethylphosphonic acid |
| SMILES | NC(=O)C(Cc1ccc2ccccc2c1)NC(=O)C1CCCCN1C(=O)C(CSCP(=O)(O)O)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C32H39N4O7PS/c33-30(38)26(19-23-13-15-24-10-4-5-11-25(24)18-23)35-31(39)28-12-6-7-17-36(28)32(40)27(20-45-21-44(41,42)43)34-29(37)16-14-22-8-2-1-3-9-22/h1-5,8-11,13,15,18,26-28H,6-7,12,14,16-17,19-21H2,(H2,33,38)(H,34,37)(H,35,39)(H2,41,42,43) |
| InChIKey | RMAIURIYHQJXLO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.73 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|