C9H18O2S — CID 11389890
(2R,4R,5S)-2-tert-butyl-5-methyl-1,4-oxathiane 4-oxide (PubChem CID 11389890) has the molecular formula C9H18O2S and a molecular weight of 190.31 g/mol. Its IUPAC name is (2R,4R,5S)-2-tert-butyl-5-methyl-1,4-oxathiane 4-oxide.
| Compound Name | (2R,4R,5S)-2-tert-butyl-5-methyl-1,4-oxathiane 4-oxide |
|---|---|
| PubChem CID | 11389890 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2R,4R,5S)-2-tert-butyl-5-methyl-1,4-oxathiane 4-oxide |
| SMILES | C[C@H]1CO[C@H](C(C)(C)C)C[S@]1=O |
| InChI | InChI=1S/C9H18O2S/c1-7-5-11-8(6-12(7)10)9(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8-,12+/m0/s1 |
| InChIKey | HAWMHJFRCWCBLH-YVZVNANGSA-N |
| XLogP | 1.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |