C11H18FNO3 — CID 11390611
(2S)-4-fluoro-4-methyl-2-(pent-4-enoylamino)pentanoic acid (PubChem CID 11390611) has the molecular formula C11H18FNO3 and a molecular weight of 231.27 g/mol. Its IUPAC name is (2S)-4-fluoro-4-methyl-2-(pent-4-enoylamino)pentanoic acid.
| Compound Name | (2S)-4-fluoro-4-methyl-2-(pent-4-enoylamino)pentanoic acid |
|---|---|
| PubChem CID | 11390611 |
| Molecular Formula | C11H18FNO3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2S)-4-fluoro-4-methyl-2-(pent-4-enoylamino)pentanoic acid |
| SMILES | C=CCCC(=O)N[C@@H](CC(C)(C)F)C(=O)O |
| InChI | InChI=1S/C11H18FNO3/c1-4-5-6-9(14)13-8(10(15)16)7-11(2,3)12/h4,8H,1,5-7H2,2-3H3,(H,13,14)(H,15,16)/t8-/m0/s1 |
| InChIKey | WYIWQFPRFJLFKZ-QMMMGPOBSA-N |
| XLogP | 1.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|