C16H30O2Si — CID 11391919
[(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] acetate (PubChem CID 11391919) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is [(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] acetate.
| Compound Name | [(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] acetate |
|---|---|
| PubChem CID | 11391919 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | [(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] acetate |
| SMILES | C=C(C)[C@@H](C)CC/C(=C/COC(C)=O)C[Si](C)(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-13(2)14(3)8-9-16(12-19(5,6)7)10-11-18-15(4)17/h10,14H,1,8-9,11-12H2,2-7H3/b16-10-/t14-/m0/s1 |
| InChIKey | JZALBWMHOMWGRF-FBKCMUNRSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|