C22H42O2 — CID 53425386
3,7,11,15-tetramethylhexadec-2-enyl acetate (PubChem CID 53425386) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadec-2-enyl acetate.
| Compound Name | 3,7,11,15-tetramethylhexadec-2-enyl acetate |
|---|---|
| PubChem CID | 53425386 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 3,7,11,15-tetramethylhexadec-2-enyl acetate |
| SMILES | CC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H42O2/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-24-22(6)23/h16,18-20H,7-15,17H2,1-6H3 |
| InChIKey | JIGCTXHIECXYRJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|