C14H24O5Si — CID 11392428
[(1S,2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate (PubChem CID 11392428) has the molecular formula C14H24O5Si and a molecular weight of 300.43 g/mol. Its IUPAC name is [(1S,2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate.
| Compound Name | [(1S,2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
|---|---|
| PubChem CID | 11392428 |
| Molecular Formula | C14H24O5Si |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(1S,2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2O[C@@H]2C(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24O5Si/c1-8(15)17-12-10(7-9(16)11-13(12)18-11)19-20(5,6)14(2,3)4/h10-13H,7H2,1-6H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | ZYJICNGRFKIRSV-FVCCEPFGSA-N |
| XLogP | 2.05 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|