C15H30O6Si — CID 139800089
(3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(deuteriomethoxy)oxan-2-one (PubChem CID 139800089) has the molecular formula C15H30O6Si and a molecular weight of 337.50 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(deuteriomethoxy)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(deuteriomethoxy)oxan-2-one |
|---|---|
| PubChem CID | 139800089 |
| Molecular Formula | C15H30O6Si |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(deuteriomethoxy)oxan-2-one |
| SMILES | [2H]CO[C@H]1[C@H](OC[2H])[C@@H](OC[2H])C(=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O6Si/c1-15(2,3)22(7,8)20-9-10-11(17-4)12(18-5)13(19-6)14(16)21-10/h10-13H,9H2,1-8H3/t10-,11-,12+,13-/m1/s1/i4D,5D,6D |
| InChIKey | KYBLEVCAQMYOTE-XIGSGGBLSA-N |
| XLogP | 1.98 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|