C17H32O3Si — CID 11392822
(3R,5S)-3-methyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]oxolan-2-one (PubChem CID 11392822) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (3R,5S)-3-methyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]oxolan-2-one.
| Compound Name | (3R,5S)-3-methyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 11392822 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (3R,5S)-3-methyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]oxolan-2-one |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1C[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C17H32O3Si/c1-9-15(16-10-14(8)17(18)19-16)20-21(11(2)3,12(4)5)13(6)7/h9,11-16H,1,10H2,2-8H3/t14-,15+,16+/m1/s1 |
| InChIKey | PJYGFONLHPQAKX-PMPSAXMXSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|