C18H19NO4 — CID 11392832
methyl 4-[(5-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]benzoate (PubChem CID 11392832) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl 4-[(5-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]benzoate.
| Compound Name | methyl 4-[(5-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]benzoate |
|---|---|
| PubChem CID | 11392832 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl 4-[(5-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC2=CC(=O)C=C(C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-18(2,3)14-9-13(20)10-15(16(14)21)19-12-7-5-11(6-8-12)17(22)23-4/h5-10,19H,1-4H3 |
| InChIKey | PLSJHDRDODOBTG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|