C14H22F3NO2S — CID 11393203
N-ethyl-1,1,1-trifluoro-N-[(1R,2R)-2-hex-1-ynylcyclopentyl]methanesulfonamide (PubChem CID 11393203) has the molecular formula C14H22F3NO2S and a molecular weight of 325.40 g/mol. Its IUPAC name is N-ethyl-1,1,1-trifluoro-N-[(1R,2R)-2-hex-1-ynylcyclopentyl]methanesulfonamide.
| Compound Name | N-ethyl-1,1,1-trifluoro-N-[(1R,2R)-2-hex-1-ynylcyclopentyl]methanesulfonamide |
|---|---|
| PubChem CID | 11393203 |
| Molecular Formula | C14H22F3NO2S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-ethyl-1,1,1-trifluoro-N-[(1R,2R)-2-hex-1-ynylcyclopentyl]methanesulfonamide |
| SMILES | CCCCC#C[C@H]1CCC[C@H]1N(CC)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H22F3NO2S/c1-3-5-6-7-9-12-10-8-11-13(12)18(4-2)21(19,20)14(15,16)17/h12-13H,3-6,8,10-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | QBDDUFGMRXPWEN-QWHCGFSZSA-N |
| XLogP | 3.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|