C18H22N4O3 — CID 11393718
[5-(tert-butylcarbamoylamino)-2-pyridinyl] N-methyl-N-phenylcarbamate (PubChem CID 11393718) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is [5-(tert-butylcarbamoylamino)-2-pyridinyl] N-methyl-N-phenylcarbamate.
| Compound Name | [5-(tert-butylcarbamoylamino)-2-pyridinyl] N-methyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 11393718 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [5-(tert-butylcarbamoylamino)-2-pyridinyl] N-methyl-N-phenylcarbamate |
| SMILES | CN(C(=O)Oc1ccc(NC(=O)NC(C)(C)C)cn1)c1ccccc1 |
| InChI | InChI=1S/C18H22N4O3/c1-18(2,3)21-16(23)20-13-10-11-15(19-12-13)25-17(24)22(4)14-8-6-5-7-9-14/h5-12H,1-4H3,(H2,20,21,23) |
| InChIKey | POYAQTDYWGUSFR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |