About (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate
(4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate (PubChem CID 142667852) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate.
Molecular Properties
| Compound Name | (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate |
| PubChem CID | 142667852 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate |
| SMILES | Cc1cc(C)nc(OC(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C15H16N2O2/c1-11-9-12(2)16-14(10-11)19-15(18)17(3)13-7-5-4-6-8-13/h4-10H,1-3H3 |
| InChIKey | VEHRHQWFZNXKEY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate?
The IUPAC name of (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate (CID 142667852) is (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate.
What is the SMILES notation for (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate?
The canonical SMILES for (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate is Cc1cc(C)nc(OC(=O)N(C)c2ccccc2)c1.
What is the InChIKey of (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate?
The InChIKey is VEHRHQWFZNXKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-11-9-12(2)16-14(10-11)19-15(18)17(3)13-7-5-4-6-8-13/h4-10H,1-3H3.
What are the key properties of (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate?
(4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate has a molecular weight of 256.31 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethyl-2-pyridinyl) N-methyl-N-phenylcarbamate is sourced from PubChem (CID 142667852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).