C17H18O6S — CID 11393975
2-[2-(4-ethylsulfonylphenyl)-4-methoxyphenoxy]acetic acid (PubChem CID 11393975) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-[2-(4-ethylsulfonylphenyl)-4-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-(4-ethylsulfonylphenyl)-4-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 11393975 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-[2-(4-ethylsulfonylphenyl)-4-methoxyphenoxy]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(-c2cc(OC)ccc2OCC(=O)O)cc1 |
| InChI | InChI=1S/C17H18O6S/c1-3-24(20,21)14-7-4-12(5-8-14)15-10-13(22-2)6-9-16(15)23-11-17(18)19/h4-10H,3,11H2,1-2H3,(H,18,19) |
| InChIKey | NWEINDUWVIEOEE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |