C25H26N2O6 — CID 11396766
N-[(2S)-1-[[4-(2-hydroxyphenoxy)-3-oxobut-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 11396766) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is N-[(2S)-1-[[4-(2-hydroxyphenoxy)-3-oxobut-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S)-1-[[4-(2-hydroxyphenoxy)-3-oxobut-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11396766 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[(2S)-1-[[4-(2-hydroxyphenoxy)-3-oxobut-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | C=C(NC(=O)[C@H](CC(C)C)NC(=O)c1cc2ccccc2o1)C(=O)COc1ccccc1O |
| InChI | InChI=1S/C25H26N2O6/c1-15(2)12-18(27-25(31)23-13-17-8-4-6-10-21(17)33-23)24(30)26-16(3)20(29)14-32-22-11-7-5-9-19(22)28/h4-11,13,15,18,28H,3,12,14H2,1-2H3,(H,26,30)(H,27,31)/t18-/m0/s1 |
| InChIKey | VMSPNSYNAOXACH-SFHVURJKSA-N |
| XLogP | 3.56 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|