C24H34N2O3 — CID 156865073
N-[5-methyl-2-(3-oxooctan-4-ylamino)hex-1-en-3-yl]-1-benzofuran-2-carboxamide (PubChem CID 156865073) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[5-methyl-2-(3-oxooctan-4-ylamino)hex-1-en-3-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[5-methyl-2-(3-oxooctan-4-ylamino)hex-1-en-3-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 156865073 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | N-[5-methyl-2-(3-oxooctan-4-ylamino)hex-1-en-3-yl]-1-benzofuran-2-carboxamide |
| SMILES | C=C(NC(CCCC)C(=O)CC)C(CC(C)C)NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H34N2O3/c1-6-8-12-19(21(27)7-2)25-17(5)20(14-16(3)4)26-24(28)23-15-18-11-9-10-13-22(18)29-23/h9-11,13,15-16,19-20,25H,5-8,12,14H2,1-4H3,(H,26,28) |
| InChIKey | MBABASPBGLTCAG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |