C23H21ClO8 — CID 11397038
methyl (E)-4-[6-chloro-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybut-2-enoate (PubChem CID 11397038) has the molecular formula C23H21ClO8 and a molecular weight of 460.87 g/mol. Its IUPAC name is methyl (E)-4-[6-chloro-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybut-2-enoate.
| Compound Name | methyl (E)-4-[6-chloro-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybut-2-enoate |
|---|---|
| PubChem CID | 11397038 |
| Molecular Formula | C23H21ClO8 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | methyl (E)-4-[6-chloro-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybut-2-enoate |
| SMILES | COC(=O)/C=C/COc1c(-c2cc(OC)c(OC)c(OC)c2)oc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C23H21ClO8/c1-27-17-10-13(11-18(28-2)22(17)30-4)21-23(31-9-5-6-19(25)29-3)20(26)15-12-14(24)7-8-16(15)32-21/h5-8,10-12H,9H2,1-4H3/b6-5+ |
| InChIKey | RDVOYQDZARVDAK-AATRIKPKSA-N |
| XLogP | 4.25 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|