C10H19NO6S2 — CID 114000114
(2R)-2-acetamido-3-(3-ethylsulfonylpropylsulfinyl)propanoic acid (PubChem CID 114000114) has the molecular formula C10H19NO6S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(3-ethylsulfonylpropylsulfinyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(3-ethylsulfonylpropylsulfinyl)propanoic acid |
|---|---|
| PubChem CID | 114000114 |
| Molecular Formula | C10H19NO6S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (2R)-2-acetamido-3-(3-ethylsulfonylpropylsulfinyl)propanoic acid |
| SMILES | CCS(=O)(=O)CCCS(=O)C[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H19NO6S2/c1-3-19(16,17)6-4-5-18(15)7-9(10(13)14)11-8(2)12/h9H,3-7H2,1-2H3,(H,11,12)(H,13,14)/t9-,18?/m0/s1 |
| InChIKey | XCSPGUWPCYOYCS-JUGYALQGSA-N |
| XLogP | -0.85 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |