C7H12N2O5S — CID 107768598
2-acetamido-3-(2-amino-2-oxoethyl)sulfinylpropanoic acid (PubChem CID 107768598) has the molecular formula C7H12N2O5S and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-acetamido-3-(2-amino-2-oxoethyl)sulfinylpropanoic acid.
| Compound Name | 2-acetamido-3-(2-amino-2-oxoethyl)sulfinylpropanoic acid |
|---|---|
| PubChem CID | 107768598 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-acetamido-3-(2-amino-2-oxoethyl)sulfinylpropanoic acid |
| SMILES | CC(=O)NC(CS(=O)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H12N2O5S/c1-4(10)9-5(7(12)13)2-15(14)3-6(8)11/h5H,2-3H2,1H3,(H2,8,11)(H,9,10)(H,12,13) |
| InChIKey | BHBRUARCCHKEKC-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |